CAS 1171929-36-4 appears in our catalog under these names: 2-Amino-2-(4-(trifluoromethyl)phenyl)propanoic acid hydrochloride, 2-Amino-2-(4-(trifluoromethyl)phenyl)propanoic acid hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-amino-2-[4-(trifluoromethyl)phenyl]propanoic acid;hydrochloride (CAS 1171929-36-4) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: 2-amino-2-[4-(trifluoromethyl)phenyl]propanoic acid;hydrochloride. InChIKey: SHCRNSWMRQJQRU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | 2-amino-2-[4-(trifluoromethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | SHCRNSWMRQJQRU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(F)(F)F)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)