CAS 1217809-78-3 appears in our catalog under these names: (S)-3-Amino-4-(2,4,5-trifluoro-phenyl)-butyric acid hydrochloride, 95%, Sitagliptin Impurity 58 HCl, (S)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic Acid Hydrochloride, >95% (HPLC), (S)–3–AMINO–4–(2,4,5–TRIFLUORO–PHENYL)–BUTYRIC ACID–HCL. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio. Available pack sizes: 250mg, 1g, 100mg, on request, 50mg.
(3S)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride (CAS 1217809-78-3) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: (3S)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride. InChIKey: FZHZEWNJQKHBTG-RGMNGODLSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | (3S)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride |
| InChIKey | FZHZEWNJQKHBTG-RGMNGODLSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)