CAS 390815-48-2 appears in our catalog under these names: Methyl 2-amino-2-(4-(trifluoromethyl)phenyl)acetate hydrochloride 95%, Methyl 2-amino-2-(4-(trifluoromethyl)phenyl)acetate hydrochloride, 95%, Methyl amino[4-(trifluoromethyl)phenyl]acetate hydrochloride, 95%, Methyl amino[4-(trifluoromethyl)phenyl]acetate hydrochloride, 95%, 95%. Offered by: Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-amino-2-[4-(trifluoromethyl)phenyl]acetate;hydrochloride (CAS 390815-48-2) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: methyl 2-amino-2-[4-(trifluoromethyl)phenyl]acetate;hydrochloride. InChIKey: OJQJUZZRIPUIBP-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | methyl 2-amino-2-[4-(trifluoromethyl)phenyl]acetate;hydrochloride |
| InChIKey | OJQJUZZRIPUIBP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)