CAS 490034-86-1 is the registry number for (3S)–3–Amino–3–(3–(trifluoromethyl)phenyl)propanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride (CAS 490034-86-1) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: (3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride. InChIKey: VSXUXMHRGZUXDZ-QRPNPIFTSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | (3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | VSXUXMHRGZUXDZ-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)