CAS 179811-81-5 appears in our catalog under these names: methyl 2-amino-2-[3-(trifluoromethyl)phenyl]acetate hydrochloride, 95%, Methyl 2-amino-2-(3-(trifluoromethyl)phenyl)acetate hydrochloride 95%, Methyl 2-amino-2-(3-(trifluoromethyl)phenyl)acetate hydrochloride, 95%, 95%, Methyl 2-amino-2-(3-(trifluoromethyl)phenyl)acetate hydrochloride, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg.
Methyl 2-amino-2-[3-(trifluoromethyl)phenyl]acetate;hydrochloride (CAS 179811-81-5) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: methyl 2-amino-2-[3-(trifluoromethyl)phenyl]acetate;hydrochloride. InChIKey: ONARFOVIGCASPJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | methyl 2-amino-2-[3-(trifluoromethyl)phenyl]acetate;hydrochloride |
| InChIKey | ONARFOVIGCASPJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)