CAS 1909337-07-0 appears in our catalog under these names: Sitagliptin Impurity 108, Racemic 3-amino-4-(2,4,5-trifluorophenyl)butanoic acid Hydrochloride, 3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid hydrochloride, 97+%, 3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid hydrochloride. Offered by: Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: on request, 500mg, 250mg, 10g, 1g.
3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride (CAS 1909337-07-0) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: 3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride. InChIKey: FZHZEWNJQKHBTG-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | 3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride |
| InChIKey | FZHZEWNJQKHBTG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)CC(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)