Products 499995-65-2
CAS 499995-65-2 appears in our catalog under these names: (3R)-3-Amino-3-[3-(trifluoromethyl)phenyl]propanoic acid hydrochloride, 95%, (R)-3-amino-3-(3-(trifluoromethyl)phenyl)propanoic acid hcl, 95%, (3R)-3-Amino-3-(3-(trifluoromethyl)phenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
(3R)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride (CAS 499995-65-2) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: (3R)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride. InChIKey: VSXUXMHRGZUXDZ-DDWIOCJRSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | (3R)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | VSXUXMHRGZUXDZ-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)