CAS 1798747-21-3 appears in our catalog under these names: 3-Amino-2-((3,4,5-trifluorophenyl)methyl)propanoic acid hydrochloride, 95%, 3-Amino-2-((3,4,5-trifluorophenyl)methyl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(aminomethyl)-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride (CAS 1798747-21-3) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: 2-(aminomethyl)-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride. InChIKey: VJNIJLMMPBENLY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | 2-(aminomethyl)-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride |
| InChIKey | VJNIJLMMPBENLY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)CC(CN)C(=O)O.Cl |
Computed by PubChem (NCBI)