CAS 1204818-19-8 appears in our catalog under these names: Sitagliptin Impurity 17 HCl, (R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic Acid Hydrochloride, >95% (HPLC), (R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid hydrochloride, (R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid hydrochloride, 97%, 97%, (R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid hydrochloride, 97%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 1g, 25mg, 50mg, 2g, 100mg, 250mg, 5g.
(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride (CAS 1204818-19-8) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride. InChIKey: FZHZEWNJQKHBTG-FYZOBXCZSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid;hydrochloride |
| InChIKey | FZHZEWNJQKHBTG-FYZOBXCZSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)