Products 1173148-03-2
CAS 1173148-03-2 is the registry number for Pyridoxamine-d3 Dihydrochloride. Offered by: TRC. Available pack sizes: 25mg.
4-(aminomethyl)-5-(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;dihydrochloride (CAS 1173148-03-2) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 244.13 g/mol. IUPAC name: 4-(aminomethyl)-5-(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;dihydrochloride. InChIKey: HNWCOANXZNKMLR-GXXYEPOPSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 4-(aminomethyl)-5-(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;dihydrochloride |
| InChIKey | HNWCOANXZNKMLR-GXXYEPOPSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C(=C1O)CN)CO.Cl.Cl |
Computed by PubChem (NCBI)