CAS 1185508-90-0 is the registry number for 5-(3-Aminophenyl)-2,4-dihydro-3H-pyrazol-3-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
3-(3-aminophenyl)-1,4-dihydropyrazol-5-one;hydrochloride (CAS 1185508-90-0) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 3-(3-aminophenyl)-1,4-dihydropyrazol-5-one;hydrochloride. InChIKey: TUKLPKUZQXYYPZ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 3-(3-aminophenyl)-1,4-dihydropyrazol-5-one;hydrochloride |
| InChIKey | TUKLPKUZQXYYPZ-UHFFFAOYSA-N |
| SMILES | C1C(=NNC1=O)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)