CAS 1185543-38-7 is the registry number for (4-[(5-Methyl-4h-1,2,4-triazol-3-yl)methyl]phenyl)amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline;dihydrochloride (CAS 1185543-38-7) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: 4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline;dihydrochloride. InChIKey: LCWLKSLEQPHWKY-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline;dihydrochloride |
| InChIKey | LCWLKSLEQPHWKY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)CC2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)