CAS 1803592-42-8 is the registry number for (3-(1H-1,2,4-Triazol-1-ylmethyl)phenyl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[3-(1,2,4-triazol-1-ylmethyl)phenyl]methanamine;dihydrochloride (CAS 1803592-42-8) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: [3-(1,2,4-triazol-1-ylmethyl)phenyl]methanamine;dihydrochloride. InChIKey: NGRPRBGDUGDAIV-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | [3-(1,2,4-triazol-1-ylmethyl)phenyl]methanamine;dihydrochloride |
| InChIKey | NGRPRBGDUGDAIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)CN2C=NC=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)