CAS 2172576-00-8 is the registry number for 2-(4-Phenyl-1H-1,2,3-triazol-1-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-phenyltriazol-1-yl)ethanamine;dihydrochloride (CAS 2172576-00-8) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: 2-(4-phenyltriazol-1-yl)ethanamine;dihydrochloride. InChIKey: KZRDQUYZJKQRRA-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | 2-(4-phenyltriazol-1-yl)ethanamine;dihydrochloride |
| InChIKey | KZRDQUYZJKQRRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(N=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)