CAS 2174000-22-5 is the registry number for (4-Methyl-5-phenyl-4H-1,2,4-triazol-3-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (CAS 2174000-22-5) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: (4-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride. InChIKey: OCYAGBAMMDSOIH-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | (4-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| InChIKey | OCYAGBAMMDSOIH-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=C1C2=CC=CC=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)