CAS 2287285-47-4 is the registry number for (5-Benzyl-4H-1,2,4-triazol-3-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(5-benzyl-1H-1,2,4-triazol-3-yl)methanamine;dihydrochloride (CAS 2287285-47-4) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: (5-benzyl-1H-1,2,4-triazol-3-yl)methanamine;dihydrochloride. InChIKey: VYAYGEBKPCPBAE-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | (5-benzyl-1H-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| InChIKey | VYAYGEBKPCPBAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=NN2)CN.Cl.Cl |
Computed by PubChem (NCBI)