CAS 1220039-90-6 is the registry number for 2-(5-Phenyl-2H-(1,2,4)triazol-3-yl)-ethylamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 1g.
2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride (CAS 1220039-90-6) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: 2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride. InChIKey: MUQVGLQUTFWWOA-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | 2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride |
| InChIKey | MUQVGLQUTFWWOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)