Products 1559062-05-3
CAS 1559062-05-3 appears in our catalog under these names: 3-(5-Ethyl-4H-1,2,4-triazol-3-yl)aniline dihydrochloride, 97%, [3-(5-Ethyl-4h-1,2,4-triazol-3-yl)phenyl]amine dihydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-(5-ethyl-1H-1,2,4-triazol-3-yl)aniline;dihydrochloride (CAS 1559062-05-3) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: 3-(5-ethyl-1H-1,2,4-triazol-3-yl)aniline;dihydrochloride. InChIKey: FFNSYNIYBJPUEO-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | 3-(5-ethyl-1H-1,2,4-triazol-3-yl)aniline;dihydrochloride |
| InChIKey | FFNSYNIYBJPUEO-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=NN1)C2=CC(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)