CAS 2228650-07-3 is the registry number for 1-(1H-1,3-Benzodiazol-2-yl)azetidin-3-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1H-benzimidazol-2-yl)azetidin-3-amine;dihydrochloride (CAS 2228650-07-3) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: 1-(1H-benzimidazol-2-yl)azetidin-3-amine;dihydrochloride. InChIKey: KMEIRWLSFAJPQW-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | 1-(1H-benzimidazol-2-yl)azetidin-3-amine;dihydrochloride |
| InChIKey | KMEIRWLSFAJPQW-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=NC3=CC=CC=C3N2)N.Cl.Cl |
Computed by PubChem (NCBI)