CAS 1955554-32-1 is the registry number for 2-(2-Phenyl-2H-1,2,3-triazol-4-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-phenyltriazol-4-yl)ethanamine;dihydrochloride (CAS 1955554-32-1) is a chemical compound with the molecular formula C10H14Cl2N4 and a molecular weight of 261.15 g/mol. IUPAC name: 2-(2-phenyltriazol-4-yl)ethanamine;dihydrochloride. InChIKey: WJPVAKIEPPJIES-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | 2-(2-phenyltriazol-4-yl)ethanamine;dihydrochloride |
| InChIKey | WJPVAKIEPPJIES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2N=CC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)