CAS 1186195-01-6 appears in our catalog under these names: 2,2,2-Trifluoro-1-p-tolylethanamine hydrochloride, 95%, 2,2,2-Trifluoro-1-(p-tolyl)ethanamine hydrochloride, 98%, 2,2,2–Trifluoro–1–(p–tolyl)ethanamine hydrochloride, 2,2,2-Trifluoro-1-(p-tolyl)ethanamine hydrochloride, 98%, 98%, 2,2,2-Trifluoro-1-p-tolylethanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
2,2,2-trifluoro-1-(4-methylphenyl)ethanamine;hydrochloride (CAS 1186195-01-6) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-methylphenyl)ethanamine;hydrochloride. InChIKey: BAQJFAAJNRYVPI-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | BAQJFAAJNRYVPI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)