CAS 1391458-37-9 appears in our catalog under these names: (R)-2,2,2-Trifluoro-1-p-tolyl-ethylamine hydrochloride, 95%, 95%, (R)-2,2,2-Trifluoro-1-p-tolyl-ethylamine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(1R)-2,2,2-trifluoro-1-(4-methylphenyl)ethanamine;hydrochloride (CAS 1391458-37-9) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-(4-methylphenyl)ethanamine;hydrochloride. InChIKey: BAQJFAAJNRYVPI-DDWIOCJRSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-(4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | BAQJFAAJNRYVPI-DDWIOCJRSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)