CAS 1188932-41-3 is the registry number for 1-Bromo-3-(1,1-difluoroethyl)-5-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-(1,1-difluoroethyl)-5-nitrobenzene (CAS 1188932-41-3) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: 1-bromo-3-(1,1-difluoroethyl)-5-nitrobenzene. InChIKey: MVWWJNFEAJHXMT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | 1-bromo-3-(1,1-difluoroethyl)-5-nitrobenzene |
| InChIKey | MVWWJNFEAJHXMT-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)Br)[N+](=O)[O-])(F)F |
Computed by PubChem (NCBI)