CAS 1447671-74-0 is the registry number for 1-(2-Bromo-1,1-difluoroethyl)-4-nitrobenzene, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 1g, 250mg.
1-(2-bromo-1,1-difluoroethyl)-4-nitrobenzene (CAS 1447671-74-0) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: 1-(2-bromo-1,1-difluoroethyl)-4-nitrobenzene. InChIKey: QKRCUCJYDUOQCD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | 1-(2-bromo-1,1-difluoroethyl)-4-nitrobenzene |
| InChIKey | QKRCUCJYDUOQCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CBr)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)