CAS 2110119-64-5 appears in our catalog under these names: Methyl 2-amino-4-bromo-3,5-difluorobenzoate, 98%, Methyl 2-amino-4-bromo-3,5-difluorobenzoate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Methyl 2-amino-4-bromo-3,5-difluorobenzoate (CAS 2110119-64-5) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: methyl 2-amino-4-bromo-3,5-difluorobenzoate. InChIKey: NJKGERHWINRLRG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | methyl 2-amino-4-bromo-3,5-difluorobenzoate |
| InChIKey | NJKGERHWINRLRG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1N)F)Br)F |
Computed by PubChem (NCBI)