Products 1806780-04-0
CAS 1806780-04-0 is the registry number for Methyl 5-bromo-2-(difluoromethyl)nicotinate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Methyl 5-bromo-2-(difluoromethyl)pyridine-3-carboxylate (CAS 1806780-04-0) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: methyl 5-bromo-2-(difluoromethyl)pyridine-3-carboxylate. InChIKey: GCOQRWMANCXWMC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | methyl 5-bromo-2-(difluoromethyl)pyridine-3-carboxylate |
| InChIKey | GCOQRWMANCXWMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)Br)C(F)F |
Computed by PubChem (NCBI)