CAS 1529613-64-6 appears in our catalog under these names: Methyl 3-amino-4-bromo-2,6-difluorobenzoate, 95%, Methyl 3-amino-4-bromo-2,6-difluorobenzoate, Methyl 3-aMino-4-broMo-2,6-difluorobenzoate, 98%, 98%, METHYL 3-AMINO-4-BROMO-2,6-DIFLUOROBENZOATE, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 3-amino-4-bromo-2,6-difluorobenzoate (CAS 1529613-64-6) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: methyl 3-amino-4-bromo-2,6-difluorobenzoate. InChIKey: NGLQFAWDCRSRSN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | methyl 3-amino-4-bromo-2,6-difluorobenzoate |
| InChIKey | NGLQFAWDCRSRSN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1F)Br)N)F |
Computed by PubChem (NCBI)