Products 1692564-79-6
CAS 1692564-79-6 appears in our catalog under these names: Methyl 2-amino-4-bromo-3,6-difluorobenzoate, 97%, 97%, Methyl 2-amino-4-bromo-3,6-difluorobenzoate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Methyl 2-amino-4-bromo-3,6-difluorobenzoate (CAS 1692564-79-6) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: methyl 2-amino-4-bromo-3,6-difluorobenzoate. InChIKey: XXLYHVQQXMJHMG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | methyl 2-amino-4-bromo-3,6-difluorobenzoate |
| InChIKey | XXLYHVQQXMJHMG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1F)Br)F)N |
Computed by PubChem (NCBI)