Products 2267344-93-2

CAS 2267344-93-2 is the registry number for Ethyl 2-bromo-3,5-difluoroisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2-bromo-3,5-difluoropyridine-4-carboxylate (CAS 2267344-93-2) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: ethyl 2-bromo-3,5-difluoropyridine-4-carboxylate. InChIKey: VYDWOEKJCXCOHP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrF2NO2
Molecular weight266.04 g/mol
IUPAC nameethyl 2-bromo-3,5-difluoropyridine-4-carboxylate
InChIKeyVYDWOEKJCXCOHP-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=NC=C1F)Br)F

Computed by PubChem (NCBI)