CAS 1523194-44-6 appears in our catalog under these names: 2-Bromo-1-(6-(difluoromethoxy)pyridin-3-yl)ethanone, 98%, 2–Bromo–1–(6–(difluoromethoxy)pyridin–3–yl)ethanone. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2-bromo-1-[6-(difluoromethoxy)-3-pyridinyl]ethanone (CAS 1523194-44-6) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: 2-bromo-1-[6-(difluoromethoxy)-3-pyridinyl]ethanone. InChIKey: QLCNKZRPRRBRNQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | 2-bromo-1-[6-(difluoromethoxy)-3-pyridinyl]ethanone |
| InChIKey | QLCNKZRPRRBRNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)CBr)OC(F)F |
Computed by PubChem (NCBI)