Products 2883731-74-4
CAS 2883731-74-4 is the registry number for 6-Bromo-2-(difluoromethoxy)-4-methylnicotinaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-(difluoromethoxy)-4-methylpyridine-3-carbaldehyde (CAS 2883731-74-4) is a chemical compound with the molecular formula C8H6BrF2NO2 and a molecular weight of 266.04 g/mol. IUPAC name: 6-bromo-2-(difluoromethoxy)-4-methylpyridine-3-carbaldehyde. InChIKey: NPSQGOIVEIUWQI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO2 |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | 6-bromo-2-(difluoromethoxy)-4-methylpyridine-3-carbaldehyde |
| InChIKey | NPSQGOIVEIUWQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C=O)OC(F)F)Br |
Computed by PubChem (NCBI)