Products 1192829-74-5
CAS 1192829-74-5 appears in our catalog under these names: 3-Chloro-4-(difluoromethoxy)benzoic acid, 95%, 3-Chloro-4-(difluoromethoxy)benzoic acid, 97%, 3-chloro-4-(difluoromethoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-chloro-4-(difluoromethoxy)benzoic acid (CAS 1192829-74-5) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 3-chloro-4-(difluoromethoxy)benzoic acid. InChIKey: SLPNPJPSQCADEB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O3 |
|---|---|
| Molecular weight | 222.57 g/mol |
| IUPAC name | 3-chloro-4-(difluoromethoxy)benzoic acid |
| InChIKey | SLPNPJPSQCADEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)OC(F)F |
Computed by PubChem (NCBI)