CAS 97914-61-9 appears in our catalog under these names: 2-Chloro-4-(difluoromethoxy)benzoic acid, 95%, 2–Chloro–4–(difluoromethoxy)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-4-(difluoromethoxy)benzoic acid (CAS 97914-61-9) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 2-chloro-4-(difluoromethoxy)benzoic acid. InChIKey: RINVJRYLUFEKIP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O3 |
|---|---|
| Molecular weight | 222.57 g/mol |
| IUPAC name | 2-chloro-4-(difluoromethoxy)benzoic acid |
| InChIKey | RINVJRYLUFEKIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)