CAS 1879026-31-9 appears in our catalog under these names: 4-Chloro-2,3-difluoro-5-methoxybenzoic acid, 95%, 4-Chloro-2,3-difluoro-5-methoxybenzoic acid, ≥95%, ≥95%, 4-Chloro-2,3-difluoro-5-methoxybenzoic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
4-chloro-2,3-difluoro-5-methoxybenzoic acid (CAS 1879026-31-9) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 4-chloro-2,3-difluoro-5-methoxybenzoic acid. InChIKey: CPDRDLQUCLLHJI-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O3 |
|---|---|
| Molecular weight | 222.57 g/mol |
| IUPAC name | 4-chloro-2,3-difluoro-5-methoxybenzoic acid |
| InChIKey | CPDRDLQUCLLHJI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)O)F)F)Cl |
Computed by PubChem (NCBI)