Products 1630319-92-4

CAS 1630319-92-4 is the registry number for 2-(3-Chloro-2,6-difluorophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-chloro-2,6-difluorophenyl)-2-hydroxyacetic acid (CAS 1630319-92-4) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 2-(3-chloro-2,6-difluorophenyl)-2-hydroxyacetic acid. InChIKey: VSBLWJOHTSXNQE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF2O3
Molecular weight222.57 g/mol
IUPAC name2-(3-chloro-2,6-difluorophenyl)-2-hydroxyacetic acid
InChIKeyVSBLWJOHTSXNQE-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)C(C(=O)O)O)F)Cl

Computed by PubChem (NCBI)