Products 1427432-41-4
CAS 1427432-41-4 is the registry number for 2-Chloro-3-(difluoromethoxy)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-(difluoromethoxy)benzoic acid (CAS 1427432-41-4) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 2-chloro-3-(difluoromethoxy)benzoic acid. InChIKey: SDAHDSQBMPBVBH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O3 |
|---|---|
| Molecular weight | 222.57 g/mol |
| IUPAC name | 2-chloro-3-(difluoromethoxy)benzoic acid |
| InChIKey | SDAHDSQBMPBVBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)