CAS 147992-34-5 is the registry number for 4-(Chlorodifluoromethoxy)-Benzoic Acid. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 500mg.
4-[chloro(difluoro)methoxy]benzoic acid (CAS 147992-34-5) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 4-[chloro(difluoro)methoxy]benzoic acid. InChIKey: MKEUDNOXARFUQW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O3 |
|---|---|
| Molecular weight | 222.57 g/mol |
| IUPAC name | 4-[chloro(difluoro)methoxy]benzoic acid |
| InChIKey | MKEUDNOXARFUQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC(F)(F)Cl |
Computed by PubChem (NCBI)