Products 433926-80-8
CAS 433926-80-8 appears in our catalog under these names: 3-Chloro-5-(difluoromethoxy)benzoic acid, 95%, 3-Chloro-5-(difluoromethoxy)benzoic acid 97%, 3-Chloro-5-(difluoromethoxy)benzoic acid, 97%, 97%, 3-Chloro-5-(difluoromethoxy)benzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
3-chloro-5-(difluoromethoxy)benzoic acid (CAS 433926-80-8) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 3-chloro-5-(difluoromethoxy)benzoic acid. InChIKey: WOQULMFOHBBORM-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O3 |
|---|---|
| Molecular weight | 222.57 g/mol |
| IUPAC name | 3-chloro-5-(difluoromethoxy)benzoic acid |
| InChIKey | WOQULMFOHBBORM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)