CAS 1630342-54-9 is the registry number for 2-(4-Chloro-2,5-difluorophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chloro-2,5-difluorophenyl)-2-hydroxyacetic acid (CAS 1630342-54-9) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 2-(4-chloro-2,5-difluorophenyl)-2-hydroxyacetic acid. InChIKey: ZVXJVDDIHTXKOP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O3 |
|---|---|
| Molecular weight | 222.57 g/mol |
| IUPAC name | 2-(4-chloro-2,5-difluorophenyl)-2-hydroxyacetic acid |
| InChIKey | ZVXJVDDIHTXKOP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)F)C(C(=O)O)O |
Computed by PubChem (NCBI)