Products 1630465-90-5

CAS 1630465-90-5 is the registry number for 2-(2-Chloro-3,6-difluorophenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-chloro-3,6-difluorophenyl)-2-hydroxyacetic acid (CAS 1630465-90-5) is a chemical compound with the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. IUPAC name: 2-(2-chloro-3,6-difluorophenyl)-2-hydroxyacetic acid. InChIKey: AHLRROCJCNPAQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF2O3
Molecular weight222.57 g/mol
IUPAC name2-(2-chloro-3,6-difluorophenyl)-2-hydroxyacetic acid
InChIKeyAHLRROCJCNPAQZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)C(C(=O)O)O)Cl)F

Computed by PubChem (NCBI)