CAS 120083-60-5 appears in our catalog under these names: Diethyl 5-(trifluoromethyl)pyridine-2,3-dicarboxylate, 95%, Diethyl 5-(trifluoromethyl)pyridine-2,3-dicarboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
Diethyl 5-(trifluoromethyl)pyridine-2,3-dicarboxylate (CAS 120083-60-5) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: diethyl 5-(trifluoromethyl)pyridine-2,3-dicarboxylate. InChIKey: RIVCDABLYPUDER-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO4 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | diethyl 5-(trifluoromethyl)pyridine-2,3-dicarboxylate |
| InChIKey | RIVCDABLYPUDER-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)C(F)(F)F)C(=O)OCC |
Computed by PubChem (NCBI)