CAS 1458674-47-9 is the registry number for (S)-3-(((Benzyloxy)carbonyl)amino)-4,4,4-trifluorobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-4,4,4-trifluoro-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 1458674-47-9) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: (3S)-4,4,4-trifluoro-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: OMSAXGBLDRPUIP-VIFPVBQESA-N.
| Molecular formula | C12H12F3NO4 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | (3S)-4,4,4-trifluoro-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | OMSAXGBLDRPUIP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)