Products 199340-78-8

CAS 199340-78-8 is the registry number for 2-([(Benzyloxy)carbonyl](2,2,2-trifluoroethyl)amino)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[phenylmethoxycarbonyl(2,2,2-trifluoroethyl)amino]acetic acid (CAS 199340-78-8) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: 2-[phenylmethoxycarbonyl(2,2,2-trifluoroethyl)amino]acetic acid. InChIKey: KZKTUYPKXNOMKO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F3NO4
Molecular weight291.22 g/mol
IUPAC name2-[phenylmethoxycarbonyl(2,2,2-trifluoroethyl)amino]acetic acid
InChIKeyKZKTUYPKXNOMKO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)N(CC(=O)O)CC(F)(F)F

Computed by PubChem (NCBI)