CAS 139520-43-7 is the registry number for 2-([(Benzyloxy)carbonyl]amino)-3,3,3-trifluoro-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3,3,3-trifluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 139520-43-7) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: 3,3,3-trifluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: RYJHDHKGSWTBEV-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO4 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | RYJHDHKGSWTBEV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)(C(F)(F)F)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)