CAS 1373232-95-1 is the registry number for 1,3-Dimethyl 2-[2-amino-4-(trifluoromethyl)phenyl]propanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Dimethyl 2-[2-amino-4-(trifluoromethyl)phenyl]propanedioate (CAS 1373232-95-1) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: dimethyl 2-[2-amino-4-(trifluoromethyl)phenyl]propanedioate. InChIKey: BNXLTYKCKCWINU-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO4 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | dimethyl 2-[2-amino-4-(trifluoromethyl)phenyl]propanedioate |
| InChIKey | BNXLTYKCKCWINU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)C(F)(F)F)N)C(=O)OC |
Computed by PubChem (NCBI)