Products 500912-21-0

CAS 500912-21-0 is the registry number for 2-Acetamido-3-(4-(trifluoromethoxy)phenyl)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-acetamido-3-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 500912-21-0) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: 2-acetamido-3-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: UBBKYYPMLIMJNV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F3NO4
Molecular weight291.22 g/mol
IUPAC name2-acetamido-3-[4-(trifluoromethoxy)phenyl]propanoic acid
InChIKeyUBBKYYPMLIMJNV-UHFFFAOYSA-N
SMILESCC(=O)NC(CC1=CC=C(C=C1)OC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)