CAS 287210-85-9 appears in our catalog under these names: 2-((Benzyloxycarbonyl)amino)-4,4,4-trifluorobutanoic Acid (>80%), Cbz-DL-Ala(CF3)-OH 98%. Offered by: TRC, Ambeed. Available pack sizes: 100mg, 1g, 500mg, 250mg.
4,4,4-trifluoro-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 287210-85-9) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: 4,4,4-trifluoro-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: BJVBZOIXZFLGGI-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO4 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | 4,4,4-trifluoro-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | BJVBZOIXZFLGGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)