Products 1256817-13-6

CAS 1256817-13-6 is the registry number for Diethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate (CAS 1256817-13-6) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: diethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate. InChIKey: JOGBHHWDGHXLSA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F3NO4
Molecular weight291.22 g/mol
IUPAC namediethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate
InChIKeyJOGBHHWDGHXLSA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=C(C=C1)C(F)(F)F)C(=O)OCC

Computed by PubChem (NCBI)