CAS 1256817-13-6 is the registry number for Diethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate (CAS 1256817-13-6) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: diethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate. InChIKey: JOGBHHWDGHXLSA-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO4 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | diethyl 6-(trifluoromethyl)pyridine-2,3-dicarboxylate |
| InChIKey | JOGBHHWDGHXLSA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)C(F)(F)F)C(=O)OCC |
Computed by PubChem (NCBI)