CAS 1333918-49-2 appears in our catalog under these names: Methyl 4-methyl-3-{((2,2,2-trifluoroethoxy)carbonyl)amino}benzoate, 95%, Methyl 4-methyl-3-{((2,2,2-trifluoroethoxy)carbonyl)amino}benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 4-methyl-3-(2,2,2-trifluoroethoxycarbonylamino)benzoate (CAS 1333918-49-2) is a chemical compound with the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. IUPAC name: methyl 4-methyl-3-(2,2,2-trifluoroethoxycarbonylamino)benzoate. InChIKey: GJCIACULLPVASI-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO4 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | methyl 4-methyl-3-(2,2,2-trifluoroethoxycarbonylamino)benzoate |
| InChIKey | GJCIACULLPVASI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)