CAS 1204573-52-3 appears in our catalog under these names: 2-Chloro-6-fluorobenzene-1-sulfonamide, 2-Chloro-6-fluorobenzenesulfonamide. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-chloro-6-fluorobenzenesulfonamide (CAS 1204573-52-3) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 2-chloro-6-fluorobenzenesulfonamide. InChIKey: NABBMMMRMNZJNT-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 2-chloro-6-fluorobenzenesulfonamide |
| InChIKey | NABBMMMRMNZJNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)N)F |
Computed by PubChem (NCBI)